C15H23N5S — CID 62436983
N-[2-[4-(ethylaminomethyl)triazol-1-yl]ethyl]-N-(thiophen-3-ylmethyl)cyclopropanamine (PubChem CID 62436983) has the molecular formula C15H23N5S and a molecular weight of 305.45 g/mol. Its IUPAC name is N-[2-[4-(ethylaminomethyl)triazol-1-yl]ethyl]-N-(thiophen-3-ylmethyl)cyclopropanamine.
| Compound Name | N-[2-[4-(ethylaminomethyl)triazol-1-yl]ethyl]-N-(thiophen-3-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 62436983 |
| Molecular Formula | C15H23N5S |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | N-[2-[4-(ethylaminomethyl)triazol-1-yl]ethyl]-N-(thiophen-3-ylmethyl)cyclopropanamine |
| SMILES | CCNCc1cn(CCN(Cc2ccsc2)C2CC2)nn1 |
| InChI | InChI=1S/C15H23N5S/c1-2-16-9-14-11-20(18-17-14)7-6-19(15-3-4-15)10-13-5-8-21-12-13/h5,8,11-12,15-16H,2-4,6-7,9-10H2,1H3 |
| InChIKey | AUAUDGSYSVOVNC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |