About N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)acetohydrazide
N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)acetohydrazide (PubChem CID 624374) has the molecular formula C17H15ClN4O
and a molecular weight of 326.79 g/mol. Its IUPAC name is N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)acetohydrazide.
Molecular Properties
| Compound Name | N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)acetohydrazide |
| PubChem CID | 624374 |
| Molecular Formula | C17H15ClN4O |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)acetohydrazide |
| SMILES | CC(=O)NNC1=Nc2ccc(Cl)cc2C(c2ccccc2)=NC1 |
| InChI | InChI=1S/C17H15ClN4O/c1-11(23)21-22-16-10-19-17(12-5-3-2-4-6-12)14-9-13(18)7-8-15(14)20-16/h2-9H,10H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | RIYMFZCORTVORQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)acetohydrazide?
The IUPAC name of N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)acetohydrazide (CID 624374) is N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)acetohydrazide.
What is the SMILES notation for N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)acetohydrazide?
The canonical SMILES for N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)acetohydrazide is CC(=O)NNC1=Nc2ccc(Cl)cc2C(c2ccccc2)=NC1.
What is the InChIKey of N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)acetohydrazide?
The InChIKey is RIYMFZCORTVORQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClN4O/c1-11(23)21-22-16-10-19-17(12-5-3-2-4-6-12)14-9-13(18)7-8-15(14)20-16/h2-9H,10H2,1H3,(H,20,22)(H,21,23).
What are the key properties of N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)acetohydrazide?
N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)acetohydrazide has a molecular weight of 326.79 g/mol, XLogP of 2.86, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)acetohydrazide is sourced from PubChem (CID 624374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).