C12H14BrN3O — CID 62441918
N-[[3-[(4-bromopyrazol-1-yl)methyl]furan-2-yl]methyl]cyclopropanamine (PubChem CID 62441918) has the molecular formula C12H14BrN3O and a molecular weight of 296.17 g/mol. Its IUPAC name is N-[[3-[(4-bromopyrazol-1-yl)methyl]furan-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[3-[(4-bromopyrazol-1-yl)methyl]furan-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62441918 |
| Molecular Formula | C12H14BrN3O |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | N-[[3-[(4-bromopyrazol-1-yl)methyl]furan-2-yl]methyl]cyclopropanamine |
| SMILES | Brc1cnn(Cc2ccoc2CNC2CC2)c1 |
| InChI | InChI=1S/C12H14BrN3O/c13-10-5-15-16(8-10)7-9-3-4-17-12(9)6-14-11-1-2-11/h3-5,8,11,14H,1-2,6-7H2 |
| InChIKey | WOXGLELXKVNLCV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |