About [4-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylfuran-2-yl]methanamine
[4-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylfuran-2-yl]methanamine (PubChem CID 62441968) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is [4-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylfuran-2-yl]methanamine.
Molecular Properties
| Compound Name | [4-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylfuran-2-yl]methanamine |
| PubChem CID | 62441968 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | [4-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylfuran-2-yl]methanamine |
| SMILES | Cc1ncn(Cc2cc(CN)oc2C)c1C |
| InChI | InChI=1S/C12H17N3O/c1-8-9(2)15(7-14-8)6-11-4-12(5-13)16-10(11)3/h4,7H,5-6,13H2,1-3H3 |
| InChIKey | VBCTYZIUOWLBGI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylfuran-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylfuran-2-yl]methanamine?
The IUPAC name of [4-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylfuran-2-yl]methanamine (CID 62441968) is [4-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylfuran-2-yl]methanamine.
What is the SMILES notation for [4-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylfuran-2-yl]methanamine?
The canonical SMILES for [4-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylfuran-2-yl]methanamine is Cc1ncn(Cc2cc(CN)oc2C)c1C.
What is the InChIKey of [4-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylfuran-2-yl]methanamine?
The InChIKey is VBCTYZIUOWLBGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O/c1-8-9(2)15(7-14-8)6-11-4-12(5-13)16-10(11)3/h4,7H,5-6,13H2,1-3H3.
What are the key properties of [4-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylfuran-2-yl]methanamine?
[4-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylfuran-2-yl]methanamine has a molecular weight of 219.29 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4,5-dimethylimidazol-1-yl)methyl]-5-methylfuran-2-yl]methanamine is sourced from PubChem (CID 62441968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).