About 4-(4-hydroxy-3,5-dimethylphenyl)-2-methylphthalazin-1-one
4-(4-hydroxy-3,5-dimethylphenyl)-2-methylphthalazin-1-one (PubChem CID 624420) has the molecular formula C17H16N2O2
and a molecular weight of 280.33 g/mol. Its IUPAC name is 4-(4-hydroxy-3,5-dimethylphenyl)-2-methylphthalazin-1-one.
Molecular Properties
| Compound Name | 4-(4-hydroxy-3,5-dimethylphenyl)-2-methylphthalazin-1-one |
| PubChem CID | 624420 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-(4-hydroxy-3,5-dimethylphenyl)-2-methylphthalazin-1-one |
| SMILES | Cc1cc(-c2nn(C)c(=O)c3ccccc23)cc(C)c1O |
| InChI | InChI=1S/C17H16N2O2/c1-10-8-12(9-11(2)16(10)20)15-13-6-4-5-7-14(13)17(21)19(3)18-15/h4-9,20H,1-3H3 |
| InChIKey | JEUAWUYFBSCYKG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-hydroxy-3,5-dimethylphenyl)-2-methylphthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-hydroxy-3,5-dimethylphenyl)-2-methylphthalazin-1-one?
The IUPAC name of 4-(4-hydroxy-3,5-dimethylphenyl)-2-methylphthalazin-1-one (CID 624420) is 4-(4-hydroxy-3,5-dimethylphenyl)-2-methylphthalazin-1-one.
What is the SMILES notation for 4-(4-hydroxy-3,5-dimethylphenyl)-2-methylphthalazin-1-one?
The canonical SMILES for 4-(4-hydroxy-3,5-dimethylphenyl)-2-methylphthalazin-1-one is Cc1cc(-c2nn(C)c(=O)c3ccccc23)cc(C)c1O.
What is the InChIKey of 4-(4-hydroxy-3,5-dimethylphenyl)-2-methylphthalazin-1-one?
The InChIKey is JEUAWUYFBSCYKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O2/c1-10-8-12(9-11(2)16(10)20)15-13-6-4-5-7-14(13)17(21)19(3)18-15/h4-9,20H,1-3H3.
What are the key properties of 4-(4-hydroxy-3,5-dimethylphenyl)-2-methylphthalazin-1-one?
4-(4-hydroxy-3,5-dimethylphenyl)-2-methylphthalazin-1-one has a molecular weight of 280.33 g/mol, XLogP of 2.92, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hydroxy-3,5-dimethylphenyl)-2-methylphthalazin-1-one is sourced from PubChem (CID 624420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).