C15H27NO2 — CID 62446258
2-methyl-N-[[3-methyl-5-(2-methylpropoxymethyl)furan-2-yl]methyl]propan-1-amine (PubChem CID 62446258) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-methyl-N-[[3-methyl-5-(2-methylpropoxymethyl)furan-2-yl]methyl]propan-1-amine.
| Compound Name | 2-methyl-N-[[3-methyl-5-(2-methylpropoxymethyl)furan-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62446258 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 2-methyl-N-[[3-methyl-5-(2-methylpropoxymethyl)furan-2-yl]methyl]propan-1-amine |
| SMILES | Cc1cc(COCC(C)C)oc1CNCC(C)C |
| InChI | InChI=1S/C15H27NO2/c1-11(2)7-16-8-15-13(5)6-14(18-15)10-17-9-12(3)4/h6,11-12,16H,7-10H2,1-5H3 |
| InChIKey | XVBGRJVAUFZLDX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |