About 3-N-(2-methoxyethyl)-1-N,3-N-dimethylbutane-1,3-diamine
3-N-(2-methoxyethyl)-1-N,3-N-dimethylbutane-1,3-diamine (PubChem CID 62447083) has the molecular formula C9H22N2O
and a molecular weight of 174.29 g/mol. Its IUPAC name is 3-N-(2-methoxyethyl)-1-N,3-N-dimethylbutane-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-(2-methoxyethyl)-1-N,3-N-dimethylbutane-1,3-diamine |
| PubChem CID | 62447083 |
| Molecular Formula | C9H22N2O |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.17 |
| IUPAC Name | 3-N-(2-methoxyethyl)-1-N,3-N-dimethylbutane-1,3-diamine |
| SMILES | CNCCC(C)N(C)CCOC |
| InChI | InChI=1S/C9H22N2O/c1-9(5-6-10-2)11(3)7-8-12-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | MLYSWTZSXLWIJY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-N-(2-methoxyethyl)-1-N,3-N-dimethylbutane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(2-methoxyethyl)-1-N,3-N-dimethylbutane-1,3-diamine?
The IUPAC name of 3-N-(2-methoxyethyl)-1-N,3-N-dimethylbutane-1,3-diamine (CID 62447083) is 3-N-(2-methoxyethyl)-1-N,3-N-dimethylbutane-1,3-diamine.
What is the SMILES notation for 3-N-(2-methoxyethyl)-1-N,3-N-dimethylbutane-1,3-diamine?
The canonical SMILES for 3-N-(2-methoxyethyl)-1-N,3-N-dimethylbutane-1,3-diamine is CNCCC(C)N(C)CCOC.
What is the InChIKey of 3-N-(2-methoxyethyl)-1-N,3-N-dimethylbutane-1,3-diamine?
The InChIKey is MLYSWTZSXLWIJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O/c1-9(5-6-10-2)11(3)7-8-12-4/h9-10H,5-8H2,1-4H3.
What are the key properties of 3-N-(2-methoxyethyl)-1-N,3-N-dimethylbutane-1,3-diamine?
3-N-(2-methoxyethyl)-1-N,3-N-dimethylbutane-1,3-diamine has a molecular weight of 174.29 g/mol, XLogP of 0.56, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(2-methoxyethyl)-1-N,3-N-dimethylbutane-1,3-diamine is sourced from PubChem (CID 62447083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).