C12H6Cl2N2O2 — CID 624471
2,3-dichloro-10-oxidophenazin-5-ium 5-oxide (PubChem CID 624471) has the molecular formula C12H6Cl2N2O2 and a molecular weight of 281.10 g/mol. Its IUPAC name is 2,3-dichloro-10-oxidophenazin-5-ium 5-oxide.
| Compound Name | 2,3-dichloro-10-oxidophenazin-5-ium 5-oxide |
|---|---|
| PubChem CID | 624471 |
| Molecular Formula | C12H6Cl2N2O2 |
| Molecular Weight | 281.10 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 2,3-dichloro-10-oxidophenazin-5-ium 5-oxide |
| SMILES | O=[n+]1c2ccccc2n([O-])c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C12H6Cl2N2O2/c13-7-5-11-12(6-8(7)14)16(18)10-4-2-1-3-9(10)15(11)17/h1-6H |
| InChIKey | AZDHEEWHTRGFDT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 50.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.10 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|