About 2-methyl-N-propyl-3-(1,2,4-triazol-1-yl)propan-1-amine
2-methyl-N-propyl-3-(1,2,4-triazol-1-yl)propan-1-amine (PubChem CID 62447382) has the molecular formula C9H18N4
and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-methyl-N-propyl-3-(1,2,4-triazol-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | 2-methyl-N-propyl-3-(1,2,4-triazol-1-yl)propan-1-amine |
| PubChem CID | 62447382 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 2-methyl-N-propyl-3-(1,2,4-triazol-1-yl)propan-1-amine |
| SMILES | CCCNCC(C)Cn1cncn1 |
| InChI | InChI=1S/C9H18N4/c1-3-4-10-5-9(2)6-13-8-11-7-12-13/h7-10H,3-6H2,1-2H3 |
| InChIKey | AYPBMMTVIPWNBJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-propyl-3-(1,2,4-triazol-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-propyl-3-(1,2,4-triazol-1-yl)propan-1-amine?
The IUPAC name of 2-methyl-N-propyl-3-(1,2,4-triazol-1-yl)propan-1-amine (CID 62447382) is 2-methyl-N-propyl-3-(1,2,4-triazol-1-yl)propan-1-amine.
What is the SMILES notation for 2-methyl-N-propyl-3-(1,2,4-triazol-1-yl)propan-1-amine?
The canonical SMILES for 2-methyl-N-propyl-3-(1,2,4-triazol-1-yl)propan-1-amine is CCCNCC(C)Cn1cncn1.
What is the InChIKey of 2-methyl-N-propyl-3-(1,2,4-triazol-1-yl)propan-1-amine?
The InChIKey is AYPBMMTVIPWNBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4/c1-3-4-10-5-9(2)6-13-8-11-7-12-13/h7-10H,3-6H2,1-2H3.
What are the key properties of 2-methyl-N-propyl-3-(1,2,4-triazol-1-yl)propan-1-amine?
2-methyl-N-propyl-3-(1,2,4-triazol-1-yl)propan-1-amine has a molecular weight of 182.27 g/mol, XLogP of 0.91, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-propyl-3-(1,2,4-triazol-1-yl)propan-1-amine is sourced from PubChem (CID 62447382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).