About [4-fluoro-3-(1,2,4-triazol-1-ylmethyl)-1-benzothiophen-2-yl]methanamine
[4-fluoro-3-(1,2,4-triazol-1-ylmethyl)-1-benzothiophen-2-yl]methanamine (PubChem CID 62448679) has the molecular formula C12H11FN4S
and a molecular weight of 262.31 g/mol. Its IUPAC name is [4-fluoro-3-(1,2,4-triazol-1-ylmethyl)-1-benzothiophen-2-yl]methanamine.
Molecular Properties
| Compound Name | [4-fluoro-3-(1,2,4-triazol-1-ylmethyl)-1-benzothiophen-2-yl]methanamine |
| PubChem CID | 62448679 |
| Molecular Formula | C12H11FN4S |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | [4-fluoro-3-(1,2,4-triazol-1-ylmethyl)-1-benzothiophen-2-yl]methanamine |
| SMILES | NCc1sc2cccc(F)c2c1Cn1cncn1 |
| InChI | InChI=1S/C12H11FN4S/c13-9-2-1-3-10-12(9)8(11(4-14)18-10)5-17-7-15-6-16-17/h1-3,6-7H,4-5,14H2 |
| InChIKey | NTDVJUVOXGQKTP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-fluoro-3-(1,2,4-triazol-1-ylmethyl)-1-benzothiophen-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-fluoro-3-(1,2,4-triazol-1-ylmethyl)-1-benzothiophen-2-yl]methanamine?
The IUPAC name of [4-fluoro-3-(1,2,4-triazol-1-ylmethyl)-1-benzothiophen-2-yl]methanamine (CID 62448679) is [4-fluoro-3-(1,2,4-triazol-1-ylmethyl)-1-benzothiophen-2-yl]methanamine.
What is the SMILES notation for [4-fluoro-3-(1,2,4-triazol-1-ylmethyl)-1-benzothiophen-2-yl]methanamine?
The canonical SMILES for [4-fluoro-3-(1,2,4-triazol-1-ylmethyl)-1-benzothiophen-2-yl]methanamine is NCc1sc2cccc(F)c2c1Cn1cncn1.
What is the InChIKey of [4-fluoro-3-(1,2,4-triazol-1-ylmethyl)-1-benzothiophen-2-yl]methanamine?
The InChIKey is NTDVJUVOXGQKTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11FN4S/c13-9-2-1-3-10-12(9)8(11(4-14)18-10)5-17-7-15-6-16-17/h1-3,6-7H,4-5,14H2.
What are the key properties of [4-fluoro-3-(1,2,4-triazol-1-ylmethyl)-1-benzothiophen-2-yl]methanamine?
[4-fluoro-3-(1,2,4-triazol-1-ylmethyl)-1-benzothiophen-2-yl]methanamine has a molecular weight of 262.31 g/mol, XLogP of 2.14, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-fluoro-3-(1,2,4-triazol-1-ylmethyl)-1-benzothiophen-2-yl]methanamine is sourced from PubChem (CID 62448679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).