C16H25N3OS — CID 62448781
N-[[4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-1,3-thiazol-2-yl]methyl]cyclopropanamine (PubChem CID 62448781) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is N-[[4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-1,3-thiazol-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-1,3-thiazol-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62448781 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N-[[4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-1,3-thiazol-2-yl]methyl]cyclopropanamine |
| SMILES | c1sc(CNC2CC2)nc1CN1CCOC2CCCCC21 |
| InChI | InChI=1S/C16H25N3OS/c1-2-4-15-14(3-1)19(7-8-20-15)10-13-11-21-16(18-13)9-17-12-5-6-12/h11-12,14-15,17H,1-10H2 |
| InChIKey | GQTZXRXIOSESCU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |