C14H18Cl2N4O — CID 62450398
N-[[1-[2-(2,5-dichlorophenoxy)ethyl]triazol-4-yl]methyl]propan-1-amine (PubChem CID 62450398) has the molecular formula C14H18Cl2N4O and a molecular weight of 329.23 g/mol. Its IUPAC name is N-[[1-[2-(2,5-dichlorophenoxy)ethyl]triazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[2-(2,5-dichlorophenoxy)ethyl]triazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62450398 |
| Molecular Formula | C14H18Cl2N4O |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N-[[1-[2-(2,5-dichlorophenoxy)ethyl]triazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cn(CCOc2cc(Cl)ccc2Cl)nn1 |
| InChI | InChI=1S/C14H18Cl2N4O/c1-2-5-17-9-12-10-20(19-18-12)6-7-21-14-8-11(15)3-4-13(14)16/h3-4,8,10,17H,2,5-7,9H2,1H3 |
| InChIKey | ZPNIWFGNOXTWFJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|