C17H13NO4 — CID 624508
17-methoxy-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(18),2,4(8),9,15(19),16-hexaen-11-one (PubChem CID 624508) has the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. Its IUPAC name is 17-methoxy-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(18),2,4(8),9,15(19),16-hexaen-11-one.
| Compound Name | 17-methoxy-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(18),2,4(8),9,15(19),16-hexaen-11-one |
|---|---|
| PubChem CID | 624508 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 17-methoxy-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(18),2,4(8),9,15(19),16-hexaen-11-one |
| SMILES | COc1cc2c3c(c1)c1cc4c(cc1c(=O)n3CC2)OCO4 |
| InChI | InChI=1S/C17H13NO4/c1-20-10-4-9-2-3-18-16(9)12(5-10)11-6-14-15(22-8-21-14)7-13(11)17(18)19/h4-7H,2-3,8H2,1H3 |
| InChIKey | JNRBVAXDZBMQSD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|