C13H23NO2 — CID 62451338
N-[[3-methyl-5-(propoxymethyl)furan-2-yl]methyl]propan-1-amine (PubChem CID 62451338) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is N-[[3-methyl-5-(propoxymethyl)furan-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[3-methyl-5-(propoxymethyl)furan-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62451338 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | N-[[3-methyl-5-(propoxymethyl)furan-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1oc(COCCC)cc1C |
| InChI | InChI=1S/C13H23NO2/c1-4-6-14-9-13-11(3)8-12(16-13)10-15-7-5-2/h8,14H,4-7,9-10H2,1-3H3 |
| InChIKey | XYUXNRXDAITAAK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|