C21H25N3O5 — CID 6245269
4-(2-methylpropanoylamino)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide (PubChem CID 6245269) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is 4-(2-methylpropanoylamino)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-(2-methylpropanoylamino)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 6245269 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 4-(2-methylpropanoylamino)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2ccc(NC(=O)C(C)C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H25N3O5/c1-13(2)20(25)23-16-8-6-15(7-9-16)21(26)24-22-12-14-10-17(27-3)19(29-5)18(11-14)28-4/h6-13H,1-5H3,(H,23,25)(H,24,26)/b22-12- |
| InChIKey | XQPCZAIRYBPLML-UUYOSTAYSA-N |
| XLogP | 3.07 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|