C16H20BrNO2 — CID 62453015
N-[[5-[(4-bromophenoxy)methyl]furan-3-yl]methyl]-2-methylpropan-1-amine (PubChem CID 62453015) has the molecular formula C16H20BrNO2 and a molecular weight of 338.25 g/mol. Its IUPAC name is N-[[5-[(4-bromophenoxy)methyl]furan-3-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[5-[(4-bromophenoxy)methyl]furan-3-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 62453015 |
| Molecular Formula | C16H20BrNO2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | N-[[5-[(4-bromophenoxy)methyl]furan-3-yl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1coc(COc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C16H20BrNO2/c1-12(2)8-18-9-13-7-16(19-10-13)11-20-15-5-3-14(17)4-6-15/h3-7,10,12,18H,8-9,11H2,1-2H3 |
| InChIKey | QIFPSOPALORNAK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |