C15H19NO2 — CID 62453604
N-methyl-1-[2-methyl-5-[(2-methylphenoxy)methyl]furan-3-yl]methanamine (PubChem CID 62453604) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is N-methyl-1-[2-methyl-5-[(2-methylphenoxy)methyl]furan-3-yl]methanamine.
| Compound Name | N-methyl-1-[2-methyl-5-[(2-methylphenoxy)methyl]furan-3-yl]methanamine |
|---|---|
| PubChem CID | 62453604 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | N-methyl-1-[2-methyl-5-[(2-methylphenoxy)methyl]furan-3-yl]methanamine |
| SMILES | CNCc1cc(COc2ccccc2C)oc1C |
| InChI | InChI=1S/C15H19NO2/c1-11-6-4-5-7-15(11)17-10-14-8-13(9-16-3)12(2)18-14/h4-8,16H,9-10H2,1-3H3 |
| InChIKey | CUUQUQQMEUPMPE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |