About N-[[5-methyl-4-[(3,3,5-trimethylcyclohexyl)oxymethyl]furan-2-yl]methyl]ethanamine
N-[[5-methyl-4-[(3,3,5-trimethylcyclohexyl)oxymethyl]furan-2-yl]methyl]ethanamine (PubChem CID 62456208) has the molecular formula C18H31NO2
and a molecular weight of 293.45 g/mol. Its IUPAC name is N-[[5-methyl-4-[(3,3,5-trimethylcyclohexyl)oxymethyl]furan-2-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[5-methyl-4-[(3,3,5-trimethylcyclohexyl)oxymethyl]furan-2-yl]methyl]ethanamine |
| PubChem CID | 62456208 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | N-[[5-methyl-4-[(3,3,5-trimethylcyclohexyl)oxymethyl]furan-2-yl]methyl]ethanamine |
| SMILES | CCNCc1cc(COC2CC(C)CC(C)(C)C2)c(C)o1 |
| InChI | InChI=1S/C18H31NO2/c1-6-19-11-17-8-15(14(3)21-17)12-20-16-7-13(2)9-18(4,5)10-16/h8,13,16,19H,6-7,9-12H2,1-5H3 |
| InChIKey | KSFULZQHDGXOGM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[5-methyl-4-[(3,3,5-trimethylcyclohexyl)oxymethyl]furan-2-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-methyl-4-[(3,3,5-trimethylcyclohexyl)oxymethyl]furan-2-yl]methyl]ethanamine?
The IUPAC name of N-[[5-methyl-4-[(3,3,5-trimethylcyclohexyl)oxymethyl]furan-2-yl]methyl]ethanamine (CID 62456208) is N-[[5-methyl-4-[(3,3,5-trimethylcyclohexyl)oxymethyl]furan-2-yl]methyl]ethanamine.
What is the SMILES notation for N-[[5-methyl-4-[(3,3,5-trimethylcyclohexyl)oxymethyl]furan-2-yl]methyl]ethanamine?
The canonical SMILES for N-[[5-methyl-4-[(3,3,5-trimethylcyclohexyl)oxymethyl]furan-2-yl]methyl]ethanamine is CCNCc1cc(COC2CC(C)CC(C)(C)C2)c(C)o1.
What is the InChIKey of N-[[5-methyl-4-[(3,3,5-trimethylcyclohexyl)oxymethyl]furan-2-yl]methyl]ethanamine?
The InChIKey is KSFULZQHDGXOGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31NO2/c1-6-19-11-17-8-15(14(3)21-17)12-20-16-7-13(2)9-18(4,5)10-16/h8,13,16,19H,6-7,9-12H2,1-5H3.
What are the key properties of N-[[5-methyl-4-[(3,3,5-trimethylcyclohexyl)oxymethyl]furan-2-yl]methyl]ethanamine?
N-[[5-methyl-4-[(3,3,5-trimethylcyclohexyl)oxymethyl]furan-2-yl]methyl]ethanamine has a molecular weight of 293.45 g/mol, XLogP of 4.43, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-methyl-4-[(3,3,5-trimethylcyclohexyl)oxymethyl]furan-2-yl]methyl]ethanamine is sourced from PubChem (CID 62456208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).