C15H20N2O2 — CID 62456490
N-methyl-1-[5-methyl-4-(2-pyridin-2-ylethoxymethyl)furan-2-yl]methanamine (PubChem CID 62456490) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is N-methyl-1-[5-methyl-4-(2-pyridin-2-ylethoxymethyl)furan-2-yl]methanamine.
| Compound Name | N-methyl-1-[5-methyl-4-(2-pyridin-2-ylethoxymethyl)furan-2-yl]methanamine |
|---|---|
| PubChem CID | 62456490 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-methyl-1-[5-methyl-4-(2-pyridin-2-ylethoxymethyl)furan-2-yl]methanamine |
| SMILES | CNCc1cc(COCCc2ccccn2)c(C)o1 |
| InChI | InChI=1S/C15H20N2O2/c1-12-13(9-15(19-12)10-16-2)11-18-8-6-14-5-3-4-7-17-14/h3-5,7,9,16H,6,8,10-11H2,1-2H3 |
| InChIKey | KGDFVYUHJYDIFH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|