C14H26N2O2 — CID 62456814
N-methyl-1-[5-(octan-2-yloxymethyl)-1,2-oxazol-3-yl]methanamine (PubChem CID 62456814) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is N-methyl-1-[5-(octan-2-yloxymethyl)-1,2-oxazol-3-yl]methanamine.
| Compound Name | N-methyl-1-[5-(octan-2-yloxymethyl)-1,2-oxazol-3-yl]methanamine |
|---|---|
| PubChem CID | 62456814 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | N-methyl-1-[5-(octan-2-yloxymethyl)-1,2-oxazol-3-yl]methanamine |
| SMILES | CCCCCCC(C)OCc1cc(CNC)no1 |
| InChI | InChI=1S/C14H26N2O2/c1-4-5-6-7-8-12(2)17-11-14-9-13(10-15-3)16-18-14/h9,12,15H,4-8,10-11H2,1-3H3 |
| InChIKey | SXCAZBGZLQPJKI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|