C14H18N6O — CID 6245691
N-[(Z)-(1,3,5-trimethylpyrazol-4-yl)methylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide (PubChem CID 6245691) has the molecular formula C14H18N6O and a molecular weight of 286.34 g/mol. Its IUPAC name is N-[(Z)-(1,3,5-trimethylpyrazol-4-yl)methylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide.
| Compound Name | N-[(Z)-(1,3,5-trimethylpyrazol-4-yl)methylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 6245691 |
| Molecular Formula | C14H18N6O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-[(Z)-(1,3,5-trimethylpyrazol-4-yl)methylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide |
| SMILES | Cc1nn(C)c(C)c1/C=N\NC(=O)c1n[nH]c2c1CCC2 |
| InChI | InChI=1S/C14H18N6O/c1-8-11(9(2)20(3)19-8)7-15-18-14(21)13-10-5-4-6-12(10)16-17-13/h7H,4-6H2,1-3H3,(H,16,17)(H,18,21)/b15-7- |
| InChIKey | HSMLCHCTKJMNIR-CHHVJCJISA-N |
| XLogP | 1.01 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|