C10H17NO2 — CID 62457855
N-methyl-1-[3-(propan-2-yloxymethyl)furan-2-yl]methanamine (PubChem CID 62457855) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is N-methyl-1-[3-(propan-2-yloxymethyl)furan-2-yl]methanamine.
| Compound Name | N-methyl-1-[3-(propan-2-yloxymethyl)furan-2-yl]methanamine |
|---|---|
| PubChem CID | 62457855 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | N-methyl-1-[3-(propan-2-yloxymethyl)furan-2-yl]methanamine |
| SMILES | CNCc1occc1COC(C)C |
| InChI | InChI=1S/C10H17NO2/c1-8(2)13-7-9-4-5-12-10(9)6-11-3/h4-5,8,11H,6-7H2,1-3H3 |
| InChIKey | QFVGJCOHSRCJSV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |