C17H33NO2 — CID 62460585
N-[[5-(cycloheptyloxymethyl)oxolan-2-yl]methyl]-2-methylpropan-2-amine (PubChem CID 62460585) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is N-[[5-(cycloheptyloxymethyl)oxolan-2-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[5-(cycloheptyloxymethyl)oxolan-2-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 62460585 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | N-[[5-(cycloheptyloxymethyl)oxolan-2-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCC1CCC(COC2CCCCCC2)O1 |
| InChI | InChI=1S/C17H33NO2/c1-17(2,3)18-12-15-10-11-16(20-15)13-19-14-8-6-4-5-7-9-14/h14-16,18H,4-13H2,1-3H3 |
| InChIKey | IGXZOTGEAWNDPL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |