About N,N-bis(2-methoxyethyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine
N,N-bis(2-methoxyethyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine (PubChem CID 62462305) has the molecular formula C13H30N2O2
and a molecular weight of 246.39 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N,N-bis(2-methoxyethyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine |
| PubChem CID | 62462305 |
| Molecular Formula | C13H30N2O2 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | N,N-bis(2-methoxyethyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine |
| SMILES | COCCN(CCOC)CC(C)CNC(C)C |
| InChI | InChI=1S/C13H30N2O2/c1-12(2)14-10-13(3)11-15(6-8-16-4)7-9-17-5/h12-14H,6-11H2,1-5H3 |
| InChIKey | HRJWWBKRXWLPJG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-bis(2-methoxyethyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(2-methoxyethyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine?
The IUPAC name of N,N-bis(2-methoxyethyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine (CID 62462305) is N,N-bis(2-methoxyethyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine.
What is the SMILES notation for N,N-bis(2-methoxyethyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine?
The canonical SMILES for N,N-bis(2-methoxyethyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine is COCCN(CCOC)CC(C)CNC(C)C.
What is the InChIKey of N,N-bis(2-methoxyethyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine?
The InChIKey is HRJWWBKRXWLPJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30N2O2/c1-12(2)14-10-13(3)11-15(6-8-16-4)7-9-17-5/h12-14H,6-11H2,1-5H3.
What are the key properties of N,N-bis(2-methoxyethyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine?
N,N-bis(2-methoxyethyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine has a molecular weight of 246.39 g/mol, XLogP of 1.22, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(2-methoxyethyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine is sourced from PubChem (CID 62462305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).