C15H28N2O — CID 62462443
N,2,2-trimethyl-N-[[2-(propylaminomethyl)furan-3-yl]methyl]propan-1-amine (PubChem CID 62462443) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is N,2,2-trimethyl-N-[[2-(propylaminomethyl)furan-3-yl]methyl]propan-1-amine.
| Compound Name | N,2,2-trimethyl-N-[[2-(propylaminomethyl)furan-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62462443 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | N,2,2-trimethyl-N-[[2-(propylaminomethyl)furan-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1occc1CN(C)CC(C)(C)C |
| InChI | InChI=1S/C15H28N2O/c1-6-8-16-10-14-13(7-9-18-14)11-17(5)12-15(2,3)4/h7,9,16H,6,8,10-12H2,1-5H3 |
| InChIKey | COTNZBPKMBEKRS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|