C19H17FN4O3S2 — CID 6246323
(E)-N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 6246323) has the molecular formula C19H17FN4O3S2 and a molecular weight of 432.50 g/mol. Its IUPAC name is (E)-N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6246323 |
| Molecular Formula | C19H17FN4O3S2 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | (E)-N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)/C=C/c3ccc(F)cc3)cc2)s1 |
| InChI | InChI=1S/C19H17FN4O3S2/c1-2-18-22-23-19(28-18)24-29(26,27)16-10-8-15(9-11-16)21-17(25)12-5-13-3-6-14(20)7-4-13/h3-12H,2H2,1H3,(H,21,25)(H,23,24)/b12-5+ |
| InChIKey | IKQKVWNUNYXROJ-LFYBBSHMSA-N |
| XLogP | 3.69 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|