C11H15F3N2O — CID 62463881
N-propyl-4-(2,2,2-trifluoroethoxymethyl)pyridin-2-amine (PubChem CID 62463881) has the molecular formula C11H15F3N2O and a molecular weight of 248.25 g/mol. Its IUPAC name is N-propyl-4-(2,2,2-trifluoroethoxymethyl)pyridin-2-amine.
| Compound Name | N-propyl-4-(2,2,2-trifluoroethoxymethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 62463881 |
| Molecular Formula | C11H15F3N2O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N-propyl-4-(2,2,2-trifluoroethoxymethyl)pyridin-2-amine |
| SMILES | CCCNc1cc(COCC(F)(F)F)ccn1 |
| InChI | InChI=1S/C11H15F3N2O/c1-2-4-15-10-6-9(3-5-16-10)7-17-8-11(12,13)14/h3,5-6H,2,4,7-8H2,1H3,(H,15,16) |
| InChIKey | QMAATZRXJUQWLM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |