About 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyridin-2-amine
3-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyridin-2-amine (PubChem CID 62464746) has the molecular formula C8H8N6O2
and a molecular weight of 220.19 g/mol. Its IUPAC name is 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyridin-2-amine |
| PubChem CID | 62464746 |
| Molecular Formula | C8H8N6O2 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyridin-2-amine |
| SMILES | Nc1ncccc1Cn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C8H8N6O2/c9-7-6(2-1-3-10-7)4-13-5-11-8(12-13)14(15)16/h1-3,5H,4H2,(H2,9,10) |
| InChIKey | MQIREJRAOBJMOR-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyridin-2-amine?
The IUPAC name of 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyridin-2-amine (CID 62464746) is 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyridin-2-amine.
What is the SMILES notation for 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyridin-2-amine?
The canonical SMILES for 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyridin-2-amine is Nc1ncccc1Cn1cnc([N+](=O)[O-])n1.
What is the InChIKey of 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyridin-2-amine?
The InChIKey is MQIREJRAOBJMOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N6O2/c9-7-6(2-1-3-10-7)4-13-5-11-8(12-13)14(15)16/h1-3,5H,4H2,(H2,9,10).
What are the key properties of 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyridin-2-amine?
3-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyridin-2-amine has a molecular weight of 220.19 g/mol, XLogP of 0.21, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyridin-2-amine is sourced from PubChem (CID 62464746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).