About [2-(2-acetyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenyl] (E)-3-phenylprop-2-enoate
[2-(2-acetyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 6246488) has the molecular formula C26H22N2O3
and a molecular weight of 410.47 g/mol. Its IUPAC name is [2-(2-acetyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenyl] (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | [2-(2-acetyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenyl] (E)-3-phenylprop-2-enoate |
| PubChem CID | 6246488 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [2-(2-acetyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | CC(=O)N1N=C(c2ccccc2OC(=O)/C=C/c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C26H22N2O3/c1-19(29)28-24(21-12-6-3-7-13-21)18-23(27-28)22-14-8-9-15-25(22)31-26(30)17-16-20-10-4-2-5-11-20/h2-17,24H,18H2,1H3/b17-16+ |
| InChIKey | ZGSVWJBOAOADQN-WUKNDPDISA-N |
| XLogP | 5.00 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-acetyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenyl] (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-acetyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenyl] (E)-3-phenylprop-2-enoate?
The IUPAC name of [2-(2-acetyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenyl] (E)-3-phenylprop-2-enoate (CID 6246488) is [2-(2-acetyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenyl] (E)-3-phenylprop-2-enoate.
What is the SMILES notation for [2-(2-acetyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenyl] (E)-3-phenylprop-2-enoate?
The canonical SMILES for [2-(2-acetyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenyl] (E)-3-phenylprop-2-enoate is CC(=O)N1N=C(c2ccccc2OC(=O)/C=C/c2ccccc2)CC1c1ccccc1.
What is the InChIKey of [2-(2-acetyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenyl] (E)-3-phenylprop-2-enoate?
The InChIKey is ZGSVWJBOAOADQN-WUKNDPDISA-N. The full InChI is InChI=1S/C26H22N2O3/c1-19(29)28-24(21-12-6-3-7-13-21)18-23(27-28)22-14-8-9-15-25(22)31-26(30)17-16-20-10-4-2-5-11-20/h2-17,24H,18H2,1H3/b17-16+.
What are the key properties of [2-(2-acetyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenyl] (E)-3-phenylprop-2-enoate?
[2-(2-acetyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenyl] (E)-3-phenylprop-2-enoate has a molecular weight of 410.47 g/mol, XLogP of 5.00, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-acetyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenyl] (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 6246488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).