C15H24N2O — CID 62465669
4-[(3,3,5-trimethylcyclohexyl)oxymethyl]pyridin-2-amine (PubChem CID 62465669) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 4-[(3,3,5-trimethylcyclohexyl)oxymethyl]pyridin-2-amine.
| Compound Name | 4-[(3,3,5-trimethylcyclohexyl)oxymethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 62465669 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 4-[(3,3,5-trimethylcyclohexyl)oxymethyl]pyridin-2-amine |
| SMILES | CC1CC(OCc2ccnc(N)c2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H24N2O/c1-11-6-13(9-15(2,3)8-11)18-10-12-4-5-17-14(16)7-12/h4-5,7,11,13H,6,8-10H2,1-3H3,(H2,16,17) |
| InChIKey | QIKRLZHOFVEGIK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |