C11H13N3O2S — CID 62466141
3-[[2-(ethylamino)-4-pyridinyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 62466141) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 3-[[2-(ethylamino)-4-pyridinyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[[2-(ethylamino)-4-pyridinyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 62466141 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 3-[[2-(ethylamino)-4-pyridinyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCNc1cc(CN2C(=O)CSC2=O)ccn1 |
| InChI | InChI=1S/C11H13N3O2S/c1-2-12-9-5-8(3-4-13-9)6-14-10(15)7-17-11(14)16/h3-5H,2,6-7H2,1H3,(H,12,13) |
| InChIKey | NNVGKBPAMCNVQR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|