C12H16N4S — CID 62468038
N-ethyl-3-[(1-methylpyrazol-4-yl)sulfanylmethyl]pyridin-2-amine (PubChem CID 62468038) has the molecular formula C12H16N4S and a molecular weight of 248.36 g/mol. Its IUPAC name is N-ethyl-3-[(1-methylpyrazol-4-yl)sulfanylmethyl]pyridin-2-amine.
| Compound Name | N-ethyl-3-[(1-methylpyrazol-4-yl)sulfanylmethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 62468038 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N-ethyl-3-[(1-methylpyrazol-4-yl)sulfanylmethyl]pyridin-2-amine |
| SMILES | CCNc1ncccc1CSc1cnn(C)c1 |
| InChI | InChI=1S/C12H16N4S/c1-3-13-12-10(5-4-6-14-12)9-17-11-7-15-16(2)8-11/h4-8H,3,9H2,1-2H3,(H,13,14) |
| InChIKey | IVJGQEHYKRZHHX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |