C15H22FN3O — CID 62468640
3-fluoro-4-[[2-(3-hydroxypropyl)pyrrolidin-1-yl]methyl]benzenecarboximidamide (PubChem CID 62468640) has the molecular formula C15H22FN3O and a molecular weight of 279.36 g/mol. Its IUPAC name is 3-fluoro-4-[[2-(3-hydroxypropyl)pyrrolidin-1-yl]methyl]benzenecarboximidamide.
| Compound Name | 3-fluoro-4-[[2-(3-hydroxypropyl)pyrrolidin-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 62468640 |
| Molecular Formula | C15H22FN3O |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 3-fluoro-4-[[2-(3-hydroxypropyl)pyrrolidin-1-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN2CCCC2CCCO)c(F)c1 |
| InChI | InChI=1S/C15H22FN3O/c16-14-9-11(15(17)18)5-6-12(14)10-19-7-1-3-13(19)4-2-8-20/h5-6,9,13,20H,1-4,7-8,10H2,(H3,17,18) |
| InChIKey | BKCDPYWQJZMPNN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|