About 3-[1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-2-yl]propan-1-ol
3-[1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-2-yl]propan-1-ol (PubChem CID 62468844) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-[1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-2-yl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-2-yl]propan-1-ol |
| PubChem CID | 62468844 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 3-[1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-2-yl]propan-1-ol |
| SMILES | OCCCC1CCCN1Cc1ncno1 |
| InChI | InChI=1S/C10H17N3O2/c14-6-2-4-9-3-1-5-13(9)7-10-11-8-12-15-10/h8-9,14H,1-7H2 |
| InChIKey | IWWLUSQVGCWGJY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-2-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-2-yl]propan-1-ol?
The IUPAC name of 3-[1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-2-yl]propan-1-ol (CID 62468844) is 3-[1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-2-yl]propan-1-ol.
What is the SMILES notation for 3-[1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-2-yl]propan-1-ol?
The canonical SMILES for 3-[1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-2-yl]propan-1-ol is OCCCC1CCCN1Cc1ncno1.
What is the InChIKey of 3-[1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-2-yl]propan-1-ol?
The InChIKey is IWWLUSQVGCWGJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c14-6-2-4-9-3-1-5-13(9)7-10-11-8-12-15-10/h8-9,14H,1-7H2.
What are the key properties of 3-[1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-2-yl]propan-1-ol?
3-[1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-2-yl]propan-1-ol has a molecular weight of 211.26 g/mol, XLogP of 0.81, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(1,2,4-oxadiazol-5-ylmethyl)pyrrolidin-2-yl]propan-1-ol is sourced from PubChem (CID 62468844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).