C15H23NO3S — CID 62469370
3-[1-(2-phenylethylsulfonyl)pyrrolidin-2-yl]propan-1-ol (PubChem CID 62469370) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 3-[1-(2-phenylethylsulfonyl)pyrrolidin-2-yl]propan-1-ol.
| Compound Name | 3-[1-(2-phenylethylsulfonyl)pyrrolidin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 62469370 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 3-[1-(2-phenylethylsulfonyl)pyrrolidin-2-yl]propan-1-ol |
| SMILES | O=S(=O)(CCc1ccccc1)N1CCCC1CCCO |
| InChI | InChI=1S/C15H23NO3S/c17-12-5-9-15-8-4-11-16(15)20(18,19)13-10-14-6-2-1-3-7-14/h1-3,6-7,15,17H,4-5,8-13H2 |
| InChIKey | KBOPETHUYHYYLR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |