C11H20N4 — CID 62469778
N-ethyl-N-[(2-hydrazinyl-3-pyridinyl)methyl]propan-2-amine (PubChem CID 62469778) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is N-ethyl-N-[(2-hydrazinyl-3-pyridinyl)methyl]propan-2-amine.
| Compound Name | N-ethyl-N-[(2-hydrazinyl-3-pyridinyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 62469778 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N-ethyl-N-[(2-hydrazinyl-3-pyridinyl)methyl]propan-2-amine |
| SMILES | CCN(Cc1cccnc1NN)C(C)C |
| InChI | InChI=1S/C11H20N4/c1-4-15(9(2)3)8-10-6-5-7-13-11(10)14-12/h5-7,9H,4,8,12H2,1-3H3,(H,13,14) |
| InChIKey | BGOXDQVRHHVSKH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|