C9H8N4O3 — CID 62469803
3-(2-methyl-5-nitrophenyl)-1,2,4-oxadiazol-5-amine (PubChem CID 62469803) has the molecular formula C9H8N4O3 and a molecular weight of 220.19 g/mol. Its IUPAC name is 3-(2-methyl-5-nitrophenyl)-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(2-methyl-5-nitrophenyl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 62469803 |
| Molecular Formula | C9H8N4O3 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 3-(2-methyl-5-nitrophenyl)-1,2,4-oxadiazol-5-amine |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-c1noc(N)n1 |
| InChI | InChI=1S/C9H8N4O3/c1-5-2-3-6(13(14)15)4-7(5)8-11-9(10)16-12-8/h2-4H,1H3,(H2,10,11,12) |
| InChIKey | ONAFZMRSBNTHRO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|