C14H22N4O — CID 62470053
1-[[2-(propylamino)-3-pyridinyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 62470053) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 1-[[2-(propylamino)-3-pyridinyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[[2-(propylamino)-3-pyridinyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 62470053 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 1-[[2-(propylamino)-3-pyridinyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | CCCNc1ncccc1CN1CCCC1C(N)=O |
| InChI | InChI=1S/C14H22N4O/c1-2-7-16-14-11(5-3-8-17-14)10-18-9-4-6-12(18)13(15)19/h3,5,8,12H,2,4,6-7,9-10H2,1H3,(H2,15,19)(H,16,17) |
| InChIKey | DFDNOKVSKSTDMW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |