About N-[(2-hydrazinyl-4-pyridinyl)methyl]-N,2-dimethylbutan-1-amine
N-[(2-hydrazinyl-4-pyridinyl)methyl]-N,2-dimethylbutan-1-amine (PubChem CID 62470146) has the molecular formula C12H22N4
and a molecular weight of 222.34 g/mol. Its IUPAC name is N-[(2-hydrazinyl-4-pyridinyl)methyl]-N,2-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | N-[(2-hydrazinyl-4-pyridinyl)methyl]-N,2-dimethylbutan-1-amine |
| PubChem CID | 62470146 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | N-[(2-hydrazinyl-4-pyridinyl)methyl]-N,2-dimethylbutan-1-amine |
| SMILES | CCC(C)CN(C)Cc1ccnc(NN)c1 |
| InChI | InChI=1S/C12H22N4/c1-4-10(2)8-16(3)9-11-5-6-14-12(7-11)15-13/h5-7,10H,4,8-9,13H2,1-3H3,(H,14,15) |
| InChIKey | DKPGNNGDNKLUFP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-hydrazinyl-4-pyridinyl)methyl]-N,2-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-hydrazinyl-4-pyridinyl)methyl]-N,2-dimethylbutan-1-amine?
The IUPAC name of N-[(2-hydrazinyl-4-pyridinyl)methyl]-N,2-dimethylbutan-1-amine (CID 62470146) is N-[(2-hydrazinyl-4-pyridinyl)methyl]-N,2-dimethylbutan-1-amine.
What is the SMILES notation for N-[(2-hydrazinyl-4-pyridinyl)methyl]-N,2-dimethylbutan-1-amine?
The canonical SMILES for N-[(2-hydrazinyl-4-pyridinyl)methyl]-N,2-dimethylbutan-1-amine is CCC(C)CN(C)Cc1ccnc(NN)c1.
What is the InChIKey of N-[(2-hydrazinyl-4-pyridinyl)methyl]-N,2-dimethylbutan-1-amine?
The InChIKey is DKPGNNGDNKLUFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4/c1-4-10(2)8-16(3)9-11-5-6-14-12(7-11)15-13/h5-7,10H,4,8-9,13H2,1-3H3,(H,14,15).
What are the key properties of N-[(2-hydrazinyl-4-pyridinyl)methyl]-N,2-dimethylbutan-1-amine?
N-[(2-hydrazinyl-4-pyridinyl)methyl]-N,2-dimethylbutan-1-amine has a molecular weight of 222.34 g/mol, XLogP of 1.85, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-hydrazinyl-4-pyridinyl)methyl]-N,2-dimethylbutan-1-amine is sourced from PubChem (CID 62470146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).