C12H19ClN2 — CID 62470184
N-[(2-chloro-3-pyridinyl)methyl]-N-methylpentan-2-amine (PubChem CID 62470184) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is N-[(2-chloro-3-pyridinyl)methyl]-N-methylpentan-2-amine.
| Compound Name | N-[(2-chloro-3-pyridinyl)methyl]-N-methylpentan-2-amine |
|---|---|
| PubChem CID | 62470184 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | N-[(2-chloro-3-pyridinyl)methyl]-N-methylpentan-2-amine |
| SMILES | CCCC(C)N(C)Cc1cccnc1Cl |
| InChI | InChI=1S/C12H19ClN2/c1-4-6-10(2)15(3)9-11-7-5-8-14-12(11)13/h5,7-8,10H,4,6,9H2,1-3H3 |
| InChIKey | QFQFTMCAHQHLJR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|