C21H14O6S2 — CID 6247052
(2Z)-2-[(2E,4E)-5-(3-hydroxy-1,1-dioxo-1-benzothiophen-2-yl)penta-2,4-dienylidene]-1,1-dioxo-1-benzothiophen-3-one (PubChem CID 6247052) has the molecular formula C21H14O6S2 and a molecular weight of 426.47 g/mol. Its IUPAC name is (2Z)-2-[(2E,4E)-5-(3-hydroxy-1,1-dioxo-1-benzothiophen-2-yl)penta-2,4-dienylidene]-1,1-dioxo-1-benzothiophen-3-one.
| Compound Name | (2Z)-2-[(2E,4E)-5-(3-hydroxy-1,1-dioxo-1-benzothiophen-2-yl)penta-2,4-dienylidene]-1,1-dioxo-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 6247052 |
| Molecular Formula | C21H14O6S2 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | (2Z)-2-[(2E,4E)-5-(3-hydroxy-1,1-dioxo-1-benzothiophen-2-yl)penta-2,4-dienylidene]-1,1-dioxo-1-benzothiophen-3-one |
| SMILES | O=C1/C(=C/C=C/C=C/C2=C(O)c3ccccc3S2(=O)=O)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C21H14O6S2/c22-20-14-8-4-6-10-16(14)28(24,25)18(20)12-2-1-3-13-19-21(23)15-9-5-7-11-17(15)29(19,26)27/h1-13,22H/b3-1+,12-2+,19-13- |
| InChIKey | DRNUFORIKYUGHQ-SLIINJFWSA-N |
| XLogP | 3.37 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|