C8H5F2N3O — CID 62470899
3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-amine (PubChem CID 62470899) has the molecular formula C8H5F2N3O and a molecular weight of 197.14 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 62470899 |
| Molecular Formula | C8H5F2N3O |
| Molecular Weight | 197.14 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 3-(3,5-difluorophenyl)-1,2,4-oxadiazol-5-amine |
| SMILES | Nc1nc(-c2cc(F)cc(F)c2)no1 |
| InChI | InChI=1S/C8H5F2N3O/c9-5-1-4(2-6(10)3-5)7-12-8(11)14-13-7/h1-3H,(H2,11,12,13) |
| InChIKey | OYVVCLXVSGWKSD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.14 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |