C9H9N3O — CID 62471073
3-(3-methylphenyl)-1,2,4-oxadiazol-5-amine (PubChem CID 62471073) has the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. Its IUPAC name is 3-(3-methylphenyl)-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(3-methylphenyl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 62471073 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 3-(3-methylphenyl)-1,2,4-oxadiazol-5-amine |
| SMILES | Cc1cccc(-c2noc(N)n2)c1 |
| InChI | InChI=1S/C9H9N3O/c1-6-3-2-4-7(5-6)8-11-9(10)13-12-8/h2-5H,1H3,(H2,10,11,12) |
| InChIKey | ZNLNSXUTISVCFC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |