About [3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-2-pyridinyl]hydrazine
[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-2-pyridinyl]hydrazine (PubChem CID 62471565) has the molecular formula C15H18N4
and a molecular weight of 254.34 g/mol. Its IUPAC name is [3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-2-pyridinyl]hydrazine.
Molecular Properties
| Compound Name | [3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-2-pyridinyl]hydrazine |
| PubChem CID | 62471565 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | [3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-2-pyridinyl]hydrazine |
| SMILES | NNc1ncccc1CN1CCCc2ccccc21 |
| InChI | InChI=1S/C15H18N4/c16-18-15-13(6-3-9-17-15)11-19-10-4-7-12-5-1-2-8-14(12)19/h1-3,5-6,8-9H,4,7,10-11,16H2,(H,17,18) |
| InChIKey | ZKFKQCDLRBEFLJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-2-pyridinyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-2-pyridinyl]hydrazine?
The IUPAC name of [3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-2-pyridinyl]hydrazine (CID 62471565) is [3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-2-pyridinyl]hydrazine.
What is the SMILES notation for [3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-2-pyridinyl]hydrazine?
The canonical SMILES for [3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-2-pyridinyl]hydrazine is NNc1ncccc1CN1CCCc2ccccc21.
What is the InChIKey of [3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-2-pyridinyl]hydrazine?
The InChIKey is ZKFKQCDLRBEFLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4/c16-18-15-13(6-3-9-17-15)11-19-10-4-7-12-5-1-2-8-14(12)19/h1-3,5-6,8-9H,4,7,10-11,16H2,(H,17,18).
What are the key properties of [3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-2-pyridinyl]hydrazine?
[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-2-pyridinyl]hydrazine has a molecular weight of 254.34 g/mol, XLogP of 2.32, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-2-pyridinyl]hydrazine is sourced from PubChem (CID 62471565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).