C13H22N4 — CID 62472034
[3-[(2,3-dimethylpiperidin-1-yl)methyl]-2-pyridinyl]hydrazine (PubChem CID 62472034) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is [3-[(2,3-dimethylpiperidin-1-yl)methyl]-2-pyridinyl]hydrazine.
| Compound Name | [3-[(2,3-dimethylpiperidin-1-yl)methyl]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 62472034 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | [3-[(2,3-dimethylpiperidin-1-yl)methyl]-2-pyridinyl]hydrazine |
| SMILES | CC1CCCN(Cc2cccnc2NN)C1C |
| InChI | InChI=1S/C13H22N4/c1-10-5-4-8-17(11(10)2)9-12-6-3-7-15-13(12)16-14/h3,6-7,10-11H,4-5,8-9,14H2,1-2H3,(H,15,16) |
| InChIKey | FKJWDJVOZCYSKJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|