C12H15F3N2O3 — CID 62473347
2-amino-4-methoxy-N-[3-(trifluoromethoxy)phenyl]butanamide (PubChem CID 62473347) has the molecular formula C12H15F3N2O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is 2-amino-4-methoxy-N-[3-(trifluoromethoxy)phenyl]butanamide.
| Compound Name | 2-amino-4-methoxy-N-[3-(trifluoromethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 62473347 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-amino-4-methoxy-N-[3-(trifluoromethoxy)phenyl]butanamide |
| SMILES | COCCC(N)C(=O)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N2O3/c1-19-6-5-10(16)11(18)17-8-3-2-4-9(7-8)20-12(13,14)15/h2-4,7,10H,5-6,16H2,1H3,(H,17,18) |
| InChIKey | RVHODLBDKJUPJU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |