C12H25N3O4S — CID 62474673
N-[1-(2-amino-4-methoxybutanoyl)piperidin-4-yl]ethanesulfonamide (PubChem CID 62474673) has the molecular formula C12H25N3O4S and a molecular weight of 307.42 g/mol. Its IUPAC name is N-[1-(2-amino-4-methoxybutanoyl)piperidin-4-yl]ethanesulfonamide.
| Compound Name | N-[1-(2-amino-4-methoxybutanoyl)piperidin-4-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 62474673 |
| Molecular Formula | C12H25N3O4S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-[1-(2-amino-4-methoxybutanoyl)piperidin-4-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC1CCN(C(=O)C(N)CCOC)CC1 |
| InChI | InChI=1S/C12H25N3O4S/c1-3-20(17,18)14-10-4-7-15(8-5-10)12(16)11(13)6-9-19-2/h10-11,14H,3-9,13H2,1-2H3 |
| InChIKey | YAPQKNUJHONUKU-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |