About pyrazino[2,3-f][4,7]phenanthroline-2,3-dicarbonitrile
pyrazino[2,3-f][4,7]phenanthroline-2,3-dicarbonitrile (PubChem CID 624748) has the molecular formula C16H6N6
and a molecular weight of 282.27 g/mol. Its IUPAC name is pyrazino[2,3-f][4,7]phenanthroline-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | pyrazino[2,3-f][4,7]phenanthroline-2,3-dicarbonitrile |
| PubChem CID | 624748 |
| Molecular Formula | C16H6N6 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | pyrazino[2,3-f][4,7]phenanthroline-2,3-dicarbonitrile |
| SMILES | N#Cc1nc2c3ncccc3c3cccnc3c2nc1C#N |
| InChI | InChI=1S/C16H6N6/c17-7-11-12(8-18)22-16-14-10(4-2-6-20-14)9-3-1-5-19-13(9)15(16)21-11/h1-6H |
| InChIKey | ORJFLARTQGRVRL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 99.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyrazino[2,3-f][4,7]phenanthroline-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazino[2,3-f][4,7]phenanthroline-2,3-dicarbonitrile?
The IUPAC name of pyrazino[2,3-f][4,7]phenanthroline-2,3-dicarbonitrile (CID 624748) is pyrazino[2,3-f][4,7]phenanthroline-2,3-dicarbonitrile.
What is the SMILES notation for pyrazino[2,3-f][4,7]phenanthroline-2,3-dicarbonitrile?
The canonical SMILES for pyrazino[2,3-f][4,7]phenanthroline-2,3-dicarbonitrile is N#Cc1nc2c3ncccc3c3cccnc3c2nc1C#N.
What is the InChIKey of pyrazino[2,3-f][4,7]phenanthroline-2,3-dicarbonitrile?
The InChIKey is ORJFLARTQGRVRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H6N6/c17-7-11-12(8-18)22-16-14-10(4-2-6-20-14)9-3-1-5-19-13(9)15(16)21-11/h1-6H.
What are the key properties of pyrazino[2,3-f][4,7]phenanthroline-2,3-dicarbonitrile?
pyrazino[2,3-f][4,7]phenanthroline-2,3-dicarbonitrile has a molecular weight of 282.27 g/mol, XLogP of 2.47, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazino[2,3-f][4,7]phenanthroline-2,3-dicarbonitrile is sourced from PubChem (CID 624748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).