C13H16N2O6 — CID 62475221
5-[(2-amino-4-methoxybutanoyl)amino]benzene-1,3-dicarboxylic acid (PubChem CID 62475221) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is 5-[(2-amino-4-methoxybutanoyl)amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(2-amino-4-methoxybutanoyl)amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 62475221 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 5-[(2-amino-4-methoxybutanoyl)amino]benzene-1,3-dicarboxylic acid |
| SMILES | COCCC(N)C(=O)Nc1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C13H16N2O6/c1-21-3-2-10(14)11(16)15-9-5-7(12(17)18)4-8(6-9)13(19)20/h4-6,10H,2-3,14H2,1H3,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | OEDOCRJJMVBHGR-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |