About 4-methoxy-1-(1,4-thiazepan-4-yl)butan-2-amine
4-methoxy-1-(1,4-thiazepan-4-yl)butan-2-amine (PubChem CID 62476125) has the molecular formula C10H22N2OS
and a molecular weight of 218.37 g/mol. Its IUPAC name is 4-methoxy-1-(1,4-thiazepan-4-yl)butan-2-amine.
Molecular Properties
| Compound Name | 4-methoxy-1-(1,4-thiazepan-4-yl)butan-2-amine |
| PubChem CID | 62476125 |
| Molecular Formula | C10H22N2OS |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 4-methoxy-1-(1,4-thiazepan-4-yl)butan-2-amine |
| SMILES | COCCC(N)CN1CCCSCC1 |
| InChI | InChI=1S/C10H22N2OS/c1-13-6-3-10(11)9-12-4-2-7-14-8-5-12/h10H,2-9,11H2,1H3 |
| InChIKey | DOHNVPGIVFGFIB-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methoxy-1-(1,4-thiazepan-4-yl)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1-(1,4-thiazepan-4-yl)butan-2-amine?
The IUPAC name of 4-methoxy-1-(1,4-thiazepan-4-yl)butan-2-amine (CID 62476125) is 4-methoxy-1-(1,4-thiazepan-4-yl)butan-2-amine.
What is the SMILES notation for 4-methoxy-1-(1,4-thiazepan-4-yl)butan-2-amine?
The canonical SMILES for 4-methoxy-1-(1,4-thiazepan-4-yl)butan-2-amine is COCCC(N)CN1CCCSCC1.
What is the InChIKey of 4-methoxy-1-(1,4-thiazepan-4-yl)butan-2-amine?
The InChIKey is DOHNVPGIVFGFIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2OS/c1-13-6-3-10(11)9-12-4-2-7-14-8-5-12/h10H,2-9,11H2,1H3.
What are the key properties of 4-methoxy-1-(1,4-thiazepan-4-yl)butan-2-amine?
4-methoxy-1-(1,4-thiazepan-4-yl)butan-2-amine has a molecular weight of 218.37 g/mol, XLogP of 0.79, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1-(1,4-thiazepan-4-yl)butan-2-amine is sourced from PubChem (CID 62476125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).